About N-cyclopropylbenzamide
N-cyclopropylbenzamide (PubChem CID 27133) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is N-cyclopropylbenzamide.
Molecular Properties
| Compound Name | N-cyclopropylbenzamide |
| PubChem CID | 27133 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | N-cyclopropylbenzamide |
| SMILES | O=C(NC1CC1)c1ccccc1 |
| InChI | InChI=1S/C10H11NO/c12-10(11-9-6-7-9)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,11,12) |
| InChIKey | IASIJDXUZOLTAH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclopropylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropylbenzamide?
The IUPAC name of N-cyclopropylbenzamide (CID 27133) is N-cyclopropylbenzamide.
What is the SMILES notation for N-cyclopropylbenzamide?
The canonical SMILES for N-cyclopropylbenzamide is O=C(NC1CC1)c1ccccc1.
What is the InChIKey of N-cyclopropylbenzamide?
The InChIKey is IASIJDXUZOLTAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO/c12-10(11-9-6-7-9)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,11,12).
What are the key properties of N-cyclopropylbenzamide?
N-cyclopropylbenzamide has a molecular weight of 161.20 g/mol, XLogP of 1.58, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropylbenzamide is sourced from PubChem (CID 27133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).