C17H14N4O2S — CID 27134373
N-(3-cyanothiophen-2-yl)-3-(8-methyl-4-oxoquinazolin-3-yl)propanamide (PubChem CID 27134373) has the molecular formula C17H14N4O2S and a molecular weight of 338.39 g/mol. Its IUPAC name is N-(3-cyanothiophen-2-yl)-3-(8-methyl-4-oxoquinazolin-3-yl)propanamide.
| Compound Name | N-(3-cyanothiophen-2-yl)-3-(8-methyl-4-oxoquinazolin-3-yl)propanamide |
|---|---|
| PubChem CID | 27134373 |
| Molecular Formula | C17H14N4O2S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | N-(3-cyanothiophen-2-yl)-3-(8-methyl-4-oxoquinazolin-3-yl)propanamide |
| SMILES | Cc1cccc2c(=O)n(CCC(=O)Nc3sccc3C#N)cnc12 |
| InChI | InChI=1S/C17H14N4O2S/c1-11-3-2-4-13-15(11)19-10-21(17(13)23)7-5-14(22)20-16-12(9-18)6-8-24-16/h2-4,6,8,10H,5,7H2,1H3,(H,20,22) |
| InChIKey | QMHYOBVKGVVFGX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |