C17H17N5O4S — CID 55671104
ethyl 5-[3-(8-methyl-4-oxoquinazolin-3-yl)propanoylamino]thiadiazole-4-carboxylate (PubChem CID 55671104) has the molecular formula C17H17N5O4S and a molecular weight of 387.42 g/mol. Its IUPAC name is ethyl 5-[3-(8-methyl-4-oxoquinazolin-3-yl)propanoylamino]thiadiazole-4-carboxylate.
| Compound Name | ethyl 5-[3-(8-methyl-4-oxoquinazolin-3-yl)propanoylamino]thiadiazole-4-carboxylate |
|---|---|
| PubChem CID | 55671104 |
| Molecular Formula | C17H17N5O4S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | ethyl 5-[3-(8-methyl-4-oxoquinazolin-3-yl)propanoylamino]thiadiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnsc1NC(=O)CCn1cnc2c(C)cccc2c1=O |
| InChI | InChI=1S/C17H17N5O4S/c1-3-26-17(25)14-15(27-21-20-14)19-12(23)7-8-22-9-18-13-10(2)5-4-6-11(13)16(22)24/h4-6,9H,3,7-8H2,1-2H3,(H,19,23) |
| InChIKey | OMWKLFVTZSHTIT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |