C27H25NO2 — CID 27154473
(2R)-N-(2-naphthalen-1-yloxyethyl)-2,3-diphenylpropanamide (PubChem CID 27154473) has the molecular formula C27H25NO2 and a molecular weight of 395.50 g/mol. Its IUPAC name is (2R)-N-(2-naphthalen-1-yloxyethyl)-2,3-diphenylpropanamide.
| Compound Name | (2R)-N-(2-naphthalen-1-yloxyethyl)-2,3-diphenylpropanamide |
|---|---|
| PubChem CID | 27154473 |
| Molecular Formula | C27H25NO2 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | (2R)-N-(2-naphthalen-1-yloxyethyl)-2,3-diphenylpropanamide |
| SMILES | O=C(NCCOc1cccc2ccccc12)[C@H](Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H25NO2/c29-27(25(23-12-5-2-6-13-23)20-21-10-3-1-4-11-21)28-18-19-30-26-17-9-15-22-14-7-8-16-24(22)26/h1-17,25H,18-20H2,(H,28,29)/t25-/m1/s1 |
| InChIKey | AECQWJDFBMGECZ-RUZDIDTESA-N |
| XLogP | 5.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|