C16H13Cl2N3OS — CID 27161149
N-(4-amino-3,5-dichlorophenyl)-3-(1,3-benzothiazol-2-yl)propanamide (PubChem CID 27161149) has the molecular formula C16H13Cl2N3OS and a molecular weight of 366.27 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-3-(1,3-benzothiazol-2-yl)propanamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-3-(1,3-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 27161149 |
| Molecular Formula | C16H13Cl2N3OS |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-3-(1,3-benzothiazol-2-yl)propanamide |
| SMILES | Nc1c(Cl)cc(NC(=O)CCc2nc3ccccc3s2)cc1Cl |
| InChI | InChI=1S/C16H13Cl2N3OS/c17-10-7-9(8-11(18)16(10)19)20-14(22)5-6-15-21-12-3-1-2-4-13(12)23-15/h1-4,7-8H,5-6,19H2,(H,20,22) |
| InChIKey | ZIPRHFJKBUENQZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|