C20H20ClN3O3S — CID 55876746
4-[3-(1,3-benzothiazol-2-yl)propanoylamino]-2-chloro-N-(2-methoxyethyl)benzamide (PubChem CID 55876746) has the molecular formula C20H20ClN3O3S and a molecular weight of 417.92 g/mol. Its IUPAC name is 4-[3-(1,3-benzothiazol-2-yl)propanoylamino]-2-chloro-N-(2-methoxyethyl)benzamide.
| Compound Name | 4-[3-(1,3-benzothiazol-2-yl)propanoylamino]-2-chloro-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 55876746 |
| Molecular Formula | C20H20ClN3O3S |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 4-[3-(1,3-benzothiazol-2-yl)propanoylamino]-2-chloro-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccc(NC(=O)CCc2nc3ccccc3s2)cc1Cl |
| InChI | InChI=1S/C20H20ClN3O3S/c1-27-11-10-22-20(26)14-7-6-13(12-15(14)21)23-18(25)8-9-19-24-16-4-2-3-5-17(16)28-19/h2-7,12H,8-11H2,1H3,(H,22,26)(H,23,25) |
| InChIKey | ARCVIWMQRPMMBI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|