C21H20F2N4O3S2 — CID 27164492
(E)-N-[3-[[4-(difluoromethylsulfanyl)phenyl]sulfamoyl]-4-methylphenyl]-3-(1-methylpyrazol-4-yl)prop-2-enamide (PubChem CID 27164492) has the molecular formula C21H20F2N4O3S2 and a molecular weight of 478.55 g/mol. Its IUPAC name is (E)-N-[3-[[4-(difluoromethylsulfanyl)phenyl]sulfamoyl]-4-methylphenyl]-3-(1-methylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[3-[[4-(difluoromethylsulfanyl)phenyl]sulfamoyl]-4-methylphenyl]-3-(1-methylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 27164492 |
| Molecular Formula | C21H20F2N4O3S2 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | (E)-N-[3-[[4-(difluoromethylsulfanyl)phenyl]sulfamoyl]-4-methylphenyl]-3-(1-methylpyrazol-4-yl)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C=C/c2cnn(C)c2)cc1S(=O)(=O)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C21H20F2N4O3S2/c1-14-3-5-17(25-20(28)10-4-15-12-24-27(2)13-15)11-19(14)32(29,30)26-16-6-8-18(9-7-16)31-21(22)23/h3-13,21,26H,1-2H3,(H,25,28)/b10-4+ |
| InChIKey | RLVAERDRLKUMQT-ONNFQVAWSA-N |
| XLogP | 4.50 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|