C18H17N5O5S — CID 27166693
N-[4-[2-[2-(4-nitroanilino)ethylamino]-2-oxoethyl]-1,3-thiazol-2-yl]furan-2-carboxamide (PubChem CID 27166693) has the molecular formula C18H17N5O5S and a molecular weight of 415.43 g/mol. Its IUPAC name is N-[4-[2-[2-(4-nitroanilino)ethylamino]-2-oxoethyl]-1,3-thiazol-2-yl]furan-2-carboxamide.
| Compound Name | N-[4-[2-[2-(4-nitroanilino)ethylamino]-2-oxoethyl]-1,3-thiazol-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 27166693 |
| Molecular Formula | C18H17N5O5S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | N-[4-[2-[2-(4-nitroanilino)ethylamino]-2-oxoethyl]-1,3-thiazol-2-yl]furan-2-carboxamide |
| SMILES | O=C(Cc1csc(NC(=O)c2ccco2)n1)NCCNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H17N5O5S/c24-16(20-8-7-19-12-3-5-14(6-4-12)23(26)27)10-13-11-29-18(21-13)22-17(25)15-2-1-9-28-15/h1-6,9,11,19H,7-8,10H2,(H,20,24)(H,21,22,25) |
| InChIKey | IOYNMCIGFNVQOK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 139.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|