C24H15Cl2F3N6O2 — CID 2722151
4-chloro-N-[1-(4-chlorobenzoyl)-6-imino-3-[3-(trifluoromethyl)anilino]-1,2,4-triazin-5-yl]benzamide (PubChem CID 2722151) has the molecular formula C24H15Cl2F3N6O2 and a molecular weight of 547.32 g/mol. Its IUPAC name is 4-chloro-N-[1-(4-chlorobenzoyl)-6-imino-3-[3-(trifluoromethyl)anilino]-1,2,4-triazin-5-yl]benzamide.
| Compound Name | 4-chloro-N-[1-(4-chlorobenzoyl)-6-imino-3-[3-(trifluoromethyl)anilino]-1,2,4-triazin-5-yl]benzamide |
|---|---|
| PubChem CID | 2722151 |
| Molecular Formula | C24H15Cl2F3N6O2 |
| Molecular Weight | 547.32 g/mol |
| Exact Mass | 546.06 |
| IUPAC Name | 4-chloro-N-[1-(4-chlorobenzoyl)-6-imino-3-[3-(trifluoromethyl)anilino]-1,2,4-triazin-5-yl]benzamide |
| SMILES | [H]/N=c1\c(NC(=O)c2ccc(Cl)cc2)nc(Nc2cccc(C(F)(F)F)c2)nn1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H15Cl2F3N6O2/c25-16-8-4-13(5-9-16)21(36)32-20-19(30)35(22(37)14-6-10-17(26)11-7-14)34-23(33-20)31-18-3-1-2-15(12-18)24(27,28)29/h1-12,30H,(H2,31,32,33,34,36)/b30-19+ |
| InChIKey | CHLDPAADZOOHLX-NDZAJKAJSA-N |
| XLogP | 5.77 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.32 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|