C34H35FN2O5 — CID 2722339
4-[(6R,6aR,9R)-9-(4-fluorophenyl)-7-oxo-6-(4-pentoxyphenyl)-6a,8,9,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-5-yl]-4-oxobutanoic acid (PubChem CID 2722339) has the molecular formula C34H35FN2O5 and a molecular weight of 570.66 g/mol. Its IUPAC name is 4-[(6R,6aR,9R)-9-(4-fluorophenyl)-7-oxo-6-(4-pentoxyphenyl)-6a,8,9,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-5-yl]-4-oxobutanoic acid.
| Compound Name | 4-[(6R,6aR,9R)-9-(4-fluorophenyl)-7-oxo-6-(4-pentoxyphenyl)-6a,8,9,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-5-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 2722339 |
| Molecular Formula | C34H35FN2O5 |
| Molecular Weight | 570.66 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | 4-[(6R,6aR,9R)-9-(4-fluorophenyl)-7-oxo-6-(4-pentoxyphenyl)-6a,8,9,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-5-yl]-4-oxobutanoic acid |
| SMILES | CCCCCOc1ccc([C@H]2[C@H]3C(=O)C[C@@H](c4ccc(F)cc4)C=C3Nc3ccccc3N2C(=O)CCC(=O)O)cc1 |
| InChI | InChI=1S/C34H35FN2O5/c1-2-3-6-19-42-26-15-11-23(12-16-26)34-33-28(20-24(21-30(33)38)22-9-13-25(35)14-10-22)36-27-7-4-5-8-29(27)37(34)31(39)17-18-32(40)41/h4-5,7-16,20,24,33-34,36H,2-3,6,17-19,21H2,1H3,(H,40,41)/t24-,33+,34-/m0/s1 |
| InChIKey | FUEBERVTYROGHV-MITYIVFKSA-N |
| XLogP | 7.02 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.66 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|