C36H39F3N2O2 — CID 2722317
(6R,6aR,9S)-9-(4-tert-butylphenyl)-5-hexanoyl-6-[4-(trifluoromethyl)phenyl]-6a,8,9,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one (PubChem CID 2722317) has the molecular formula C36H39F3N2O2 and a molecular weight of 588.71 g/mol. Its IUPAC name is (6R,6aR,9S)-9-(4-tert-butylphenyl)-5-hexanoyl-6-[4-(trifluoromethyl)phenyl]-6a,8,9,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6R,6aR,9S)-9-(4-tert-butylphenyl)-5-hexanoyl-6-[4-(trifluoromethyl)phenyl]-6a,8,9,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 2722317 |
| Molecular Formula | C36H39F3N2O2 |
| Molecular Weight | 588.71 g/mol |
| Exact Mass | 588.30 |
| IUPAC Name | (6R,6aR,9S)-9-(4-tert-butylphenyl)-5-hexanoyl-6-[4-(trifluoromethyl)phenyl]-6a,8,9,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
| SMILES | CCCCCC(=O)N1c2ccccc2NC2=C[C@@H](c3ccc(C(C)(C)C)cc3)CC(=O)[C@@H]2[C@@H]1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C36H39F3N2O2/c1-5-6-7-12-32(43)41-30-11-9-8-10-28(30)40-29-21-25(23-13-17-26(18-14-23)35(2,3)4)22-31(42)33(29)34(41)24-15-19-27(20-16-24)36(37,38)39/h8-11,13-21,25,33-34,40H,5-7,12,22H2,1-4H3/t25-,33-,34+/m1/s1 |
| InChIKey | DCBYIJNISADDCQ-BYLXMBBZSA-N |
| XLogP | 9.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.71 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|