C34H31ClN2O2S — CID 2717548
(6S,6aR,9S)-9-(4-tert-butylphenyl)-6-(2-chlorophenyl)-5-(thiophene-2-carbonyl)-6a,8,9,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one (PubChem CID 2717548) has the molecular formula C34H31ClN2O2S and a molecular weight of 567.15 g/mol. Its IUPAC name is (6S,6aR,9S)-9-(4-tert-butylphenyl)-6-(2-chlorophenyl)-5-(thiophene-2-carbonyl)-6a,8,9,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6S,6aR,9S)-9-(4-tert-butylphenyl)-6-(2-chlorophenyl)-5-(thiophene-2-carbonyl)-6a,8,9,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 2717548 |
| Molecular Formula | C34H31ClN2O2S |
| Molecular Weight | 567.15 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | (6S,6aR,9S)-9-(4-tert-butylphenyl)-6-(2-chlorophenyl)-5-(thiophene-2-carbonyl)-6a,8,9,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
| SMILES | CC(C)(C)c1ccc([C@@H]2C=C3Nc4ccccc4N(C(=O)c4cccs4)[C@H](c4ccccc4Cl)[C@H]3C(=O)C2)cc1 |
| InChI | InChI=1S/C34H31ClN2O2S/c1-34(2,3)23-16-14-21(15-17-23)22-19-27-31(29(38)20-22)32(24-9-4-5-10-25(24)35)37(33(39)30-13-8-18-40-30)28-12-7-6-11-26(28)36-27/h4-19,22,31-32,36H,20H2,1-3H3/t22-,31-,32-/m1/s1 |
| InChIKey | BFMWOGOHEGCZQR-RZYUNOLVSA-N |
| XLogP | 8.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.15 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |