C23H22Cl2N2O2 — CID 2279168
(6R,6aR)-5-butanoyl-6-(2,4-dichlorophenyl)-6a,8,9,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one (PubChem CID 2279168) has the molecular formula C23H22Cl2N2O2 and a molecular weight of 429.35 g/mol. Its IUPAC name is (6R,6aR)-5-butanoyl-6-(2,4-dichlorophenyl)-6a,8,9,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6R,6aR)-5-butanoyl-6-(2,4-dichlorophenyl)-6a,8,9,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 2279168 |
| Molecular Formula | C23H22Cl2N2O2 |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | (6R,6aR)-5-butanoyl-6-(2,4-dichlorophenyl)-6a,8,9,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
| SMILES | CCCC(=O)N1c2ccccc2NC2=CCCC(=O)[C@@H]2[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H22Cl2N2O2/c1-2-6-21(29)27-19-9-4-3-7-17(19)26-18-8-5-10-20(28)22(18)23(27)15-12-11-14(24)13-16(15)25/h3-4,7-9,11-13,22-23,26H,2,5-6,10H2,1H3/t22-,23+/m1/s1 |
| InChIKey | UQRLPKHEVMZKNN-PKTZIBPZSA-N |
| XLogP | 6.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |