C35H38Cl2N2O2 — CID 2722305
(6R,9R)-9-(4-tert-butylphenyl)-6-(2,4-dichlorophenyl)-5-hexanoyl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one (PubChem CID 2722305) has the molecular formula C35H38Cl2N2O2 and a molecular weight of 589.61 g/mol. Its IUPAC name is (6R,9R)-9-(4-tert-butylphenyl)-6-(2,4-dichlorophenyl)-5-hexanoyl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6R,9R)-9-(4-tert-butylphenyl)-6-(2,4-dichlorophenyl)-5-hexanoyl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 2722305 |
| Molecular Formula | C35H38Cl2N2O2 |
| Molecular Weight | 589.61 g/mol |
| Exact Mass | 588.23 |
| IUPAC Name | (6R,9R)-9-(4-tert-butylphenyl)-6-(2,4-dichlorophenyl)-5-hexanoyl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
| SMILES | CCCCCC(=O)N1c2ccccc2NC2=C(C(=O)C[C@H](c3ccc(C(C)(C)C)cc3)C2)[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C35H38Cl2N2O2/c1-5-6-7-12-32(41)39-30-11-9-8-10-28(30)38-29-19-23(22-13-15-24(16-14-22)35(2,3)4)20-31(40)33(29)34(39)26-18-17-25(36)21-27(26)37/h8-11,13-18,21,23,34,38H,5-7,12,19-20H2,1-4H3/t23-,34+/m1/s1 |
| InChIKey | FCQMRHTYXCHRAB-NHOCJEJCSA-N |
| XLogP | 9.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.61 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|