C36H34Cl2N2O — CID 4235126
5-benzyl-9-(4-tert-butylphenyl)-6-(2,4-dichlorophenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one (PubChem CID 4235126) has the molecular formula C36H34Cl2N2O and a molecular weight of 581.59 g/mol. Its IUPAC name is 5-benzyl-9-(4-tert-butylphenyl)-6-(2,4-dichlorophenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 5-benzyl-9-(4-tert-butylphenyl)-6-(2,4-dichlorophenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 4235126 |
| Molecular Formula | C36H34Cl2N2O |
| Molecular Weight | 581.59 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | 5-benzyl-9-(4-tert-butylphenyl)-6-(2,4-dichlorophenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
| SMILES | CC(C)(C)c1ccc(C2CC(=O)C3=C(C2)Nc2ccccc2N(Cc2ccccc2)C3c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C36H34Cl2N2O/c1-36(2,3)26-15-13-24(14-16-26)25-19-31-34(33(41)20-25)35(28-18-17-27(37)21-29(28)38)40(22-23-9-5-4-6-10-23)32-12-8-7-11-30(32)39-31/h4-18,21,25,35,39H,19-20,22H2,1-3H3 |
| InChIKey | FLWSYWGXQYTHEH-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.59 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |