C15H19Cl2NO3 — CID 27233264
(2S)-2-(2,4-dichlorophenoxy)-N-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]propanamide (PubChem CID 27233264) has the molecular formula C15H19Cl2NO3 and a molecular weight of 332.23 g/mol. Its IUPAC name is (2S)-2-(2,4-dichlorophenoxy)-N-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]propanamide.
| Compound Name | (2S)-2-(2,4-dichlorophenoxy)-N-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 27233264 |
| Molecular Formula | C15H19Cl2NO3 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | (2S)-2-(2,4-dichlorophenoxy)-N-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]propanamide |
| SMILES | C[C@H](Oc1ccc(Cl)cc1Cl)C(=O)N[C@@H](C)[C@@H]1CCCO1 |
| InChI | InChI=1S/C15H19Cl2NO3/c1-9(13-4-3-7-20-13)18-15(19)10(2)21-14-6-5-11(16)8-12(14)17/h5-6,8-10,13H,3-4,7H2,1-2H3,(H,18,19)/t9-,10-,13-/m0/s1 |
| InChIKey | FNOFUFSMIKVFDA-KWBADKCTSA-N |
| XLogP | 3.44 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |