C16H21Cl2NO3 — CID 124753412
(2S)-2-(2,4-dichlorophenoxy)-N-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]butanamide (PubChem CID 124753412) has the molecular formula C16H21Cl2NO3 and a molecular weight of 346.25 g/mol. Its IUPAC name is (2S)-2-(2,4-dichlorophenoxy)-N-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]butanamide.
| Compound Name | (2S)-2-(2,4-dichlorophenoxy)-N-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]butanamide |
|---|---|
| PubChem CID | 124753412 |
| Molecular Formula | C16H21Cl2NO3 |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | (2S)-2-(2,4-dichlorophenoxy)-N-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]butanamide |
| SMILES | CC[C@H](Oc1ccc(Cl)cc1Cl)C(=O)N[C@H](C)[C@H]1CCCO1 |
| InChI | InChI=1S/C16H21Cl2NO3/c1-3-13(22-15-7-6-11(17)9-12(15)18)16(20)19-10(2)14-5-4-8-21-14/h6-7,9-10,13-14H,3-5,8H2,1-2H3,(H,19,20)/t10-,13+,14-/m1/s1 |
| InChIKey | LYDVQVPIQPPGQF-DDTOSNHZSA-N |
| XLogP | 3.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |