C17H16FN9S — CID 27238315
6-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 27238315) has the molecular formula C17H16FN9S and a molecular weight of 397.44 g/mol. Its IUPAC name is 6-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 27238315 |
| Molecular Formula | C17H16FN9S |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 6-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1cc(C)n2nc(SCc3nc(N)nc(Nc4ccc(F)cc4)n3)nc2n1 |
| InChI | InChI=1S/C17H16FN9S/c1-9-7-10(2)27-16(20-9)25-17(26-27)28-8-13-22-14(19)24-15(23-13)21-12-5-3-11(18)4-6-12/h3-7H,8H2,1-2H3,(H3,19,21,22,23,24) |
| InChIKey | QPIHHLWJRMWDDE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |