About 6-methoxy-1-oxidoquinolin-1-ium;dihydrate
6-methoxy-1-oxidoquinolin-1-ium;dihydrate (PubChem CID 2724229) has the molecular formula C10H13NO4
and a molecular weight of 211.22 g/mol. Its IUPAC name is 6-methoxy-1-oxidoquinolin-1-ium;dihydrate.
Molecular Properties
| Compound Name | 6-methoxy-1-oxidoquinolin-1-ium;dihydrate |
| PubChem CID | 2724229 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 6-methoxy-1-oxidoquinolin-1-ium;dihydrate |
| SMILES | COc1ccc2c(ccc[n+]2[O-])c1.O.O |
| InChI | InChI=1S/C10H9NO2.2H2O/c1-13-9-4-5-10-8(7-9)3-2-6-11(10)12;;/h2-7H,1H3;2*1H2 |
| InChIKey | FMHRKHQSELOMQN-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 99.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxy-1-oxidoquinolin-1-ium;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-1-oxidoquinolin-1-ium;dihydrate?
The IUPAC name of 6-methoxy-1-oxidoquinolin-1-ium;dihydrate (CID 2724229) is 6-methoxy-1-oxidoquinolin-1-ium;dihydrate.
What is the SMILES notation for 6-methoxy-1-oxidoquinolin-1-ium;dihydrate?
The canonical SMILES for 6-methoxy-1-oxidoquinolin-1-ium;dihydrate is COc1ccc2c(ccc[n+]2[O-])c1.O.O.
What is the InChIKey of 6-methoxy-1-oxidoquinolin-1-ium;dihydrate?
The InChIKey is FMHRKHQSELOMQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2.2H2O/c1-13-9-4-5-10-8(7-9)3-2-6-11(10)12;;/h2-7H,1H3;2*1H2.
What are the key properties of 6-methoxy-1-oxidoquinolin-1-ium;dihydrate?
6-methoxy-1-oxidoquinolin-1-ium;dihydrate has a molecular weight of 211.22 g/mol, XLogP of -0.17, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-1-oxidoquinolin-1-ium;dihydrate is sourced from PubChem (CID 2724229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).