C16H13N5S — CID 27245430
5-(1,3-benzothiazol-2-yl)-3-(4-methylphenyl)triazol-4-amine (PubChem CID 27245430) has the molecular formula C16H13N5S and a molecular weight of 307.38 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-3-(4-methylphenyl)triazol-4-amine.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-3-(4-methylphenyl)triazol-4-amine |
|---|---|
| PubChem CID | 27245430 |
| Molecular Formula | C16H13N5S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-3-(4-methylphenyl)triazol-4-amine |
| SMILES | Cc1ccc(-n2nnc(-c3nc4ccccc4s3)c2N)cc1 |
| InChI | InChI=1S/C16H13N5S/c1-10-6-8-11(9-7-10)21-15(17)14(19-20-21)16-18-12-4-2-3-5-13(12)22-16/h2-9H,17H2,1H3 |
| InChIKey | VIMILZCKRFHRMT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |