C24H19ClN2O4S — CID 2725505
3-(4-chloro-2,5-dimethoxyphenyl)-2-phenacylsulfanylquinazolin-4-one (PubChem CID 2725505) has the molecular formula C24H19ClN2O4S and a molecular weight of 466.95 g/mol. Its IUPAC name is 3-(4-chloro-2,5-dimethoxyphenyl)-2-phenacylsulfanylquinazolin-4-one.
| Compound Name | 3-(4-chloro-2,5-dimethoxyphenyl)-2-phenacylsulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 2725505 |
| Molecular Formula | C24H19ClN2O4S |
| Molecular Weight | 466.95 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | 3-(4-chloro-2,5-dimethoxyphenyl)-2-phenacylsulfanylquinazolin-4-one |
| SMILES | COc1cc(-n2c(SCC(=O)c3ccccc3)nc3ccccc3c2=O)c(OC)cc1Cl |
| InChI | InChI=1S/C24H19ClN2O4S/c1-30-21-13-19(22(31-2)12-17(21)25)27-23(29)16-10-6-7-11-18(16)26-24(27)32-14-20(28)15-8-4-3-5-9-15/h3-13H,14H2,1-2H3 |
| InChIKey | BGFOLVNLIUQZBD-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.95 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |