C14H17NO7 — CID 2725638
5-(3-carboxypropanoylamino)-2-(2-methoxyethoxy)benzoic acid (PubChem CID 2725638) has the molecular formula C14H17NO7 and a molecular weight of 311.29 g/mol. Its IUPAC name is 5-(3-carboxypropanoylamino)-2-(2-methoxyethoxy)benzoic acid.
| Compound Name | 5-(3-carboxypropanoylamino)-2-(2-methoxyethoxy)benzoic acid |
|---|---|
| PubChem CID | 2725638 |
| Molecular Formula | C14H17NO7 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 5-(3-carboxypropanoylamino)-2-(2-methoxyethoxy)benzoic acid |
| SMILES | COCCOc1ccc(NC(=O)CCC(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C14H17NO7/c1-21-6-7-22-11-3-2-9(8-10(11)14(19)20)15-12(16)4-5-13(17)18/h2-3,8H,4-7H2,1H3,(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | RDUQAZRPHUXWRV-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|