C25H30N2O6 — CID 2725782
[1-[[5-[(1-acetyloxy-2-phenylethyl)amino]-5-oxopentanoyl]amino]-2-phenylethyl] acetate (PubChem CID 2725782) has the molecular formula C25H30N2O6 and a molecular weight of 454.52 g/mol. Its IUPAC name is [1-[[5-[(1-acetyloxy-2-phenylethyl)amino]-5-oxopentanoyl]amino]-2-phenylethyl] acetate.
| Compound Name | [1-[[5-[(1-acetyloxy-2-phenylethyl)amino]-5-oxopentanoyl]amino]-2-phenylethyl] acetate |
|---|---|
| PubChem CID | 2725782 |
| Molecular Formula | C25H30N2O6 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | [1-[[5-[(1-acetyloxy-2-phenylethyl)amino]-5-oxopentanoyl]amino]-2-phenylethyl] acetate |
| SMILES | CC(=O)OC(Cc1ccccc1)NC(=O)CCCC(=O)NC(Cc1ccccc1)OC(C)=O |
| InChI | InChI=1S/C25H30N2O6/c1-18(28)32-24(16-20-10-5-3-6-11-20)26-22(30)14-9-15-23(31)27-25(33-19(2)29)17-21-12-7-4-8-13-21/h3-8,10-13,24-25H,9,14-17H2,1-2H3,(H,26,30)(H,27,31) |
| InChIKey | WYIPZUKUMNIFMP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|