C16H17FO4S — CID 2725854
1-benzylsulfonyl-3-(4-fluorophenoxy)propan-2-ol (PubChem CID 2725854) has the molecular formula C16H17FO4S and a molecular weight of 324.37 g/mol. Its IUPAC name is 1-benzylsulfonyl-3-(4-fluorophenoxy)propan-2-ol.
| Compound Name | 1-benzylsulfonyl-3-(4-fluorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 2725854 |
| Molecular Formula | C16H17FO4S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 1-benzylsulfonyl-3-(4-fluorophenoxy)propan-2-ol |
| SMILES | O=S(=O)(Cc1ccccc1)CC(O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C16H17FO4S/c17-14-6-8-16(9-7-14)21-10-15(18)12-22(19,20)11-13-4-2-1-3-5-13/h1-9,15,18H,10-12H2 |
| InChIKey | OFGCBTIWUDIFKH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |