C25H27N3O — CID 27259352
(2-anilinophenyl)-[4-(2,3-dimethylphenyl)piperazin-1-yl]methanone (PubChem CID 27259352) has the molecular formula C25H27N3O and a molecular weight of 385.51 g/mol. Its IUPAC name is (2-anilinophenyl)-[4-(2,3-dimethylphenyl)piperazin-1-yl]methanone.
| Compound Name | (2-anilinophenyl)-[4-(2,3-dimethylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 27259352 |
| Molecular Formula | C25H27N3O |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | (2-anilinophenyl)-[4-(2,3-dimethylphenyl)piperazin-1-yl]methanone |
| SMILES | Cc1cccc(N2CCN(C(=O)c3ccccc3Nc3ccccc3)CC2)c1C |
| InChI | InChI=1S/C25H27N3O/c1-19-9-8-14-24(20(19)2)27-15-17-28(18-16-27)25(29)22-12-6-7-13-23(22)26-21-10-4-3-5-11-21/h3-14,26H,15-18H2,1-2H3 |
| InChIKey | IIRXGQREACDHFV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |