C19H17FN2OS — CID 27260653
(2R)-N-(2-fluorophenyl)-2-quinolin-2-ylsulfanylbutanamide (PubChem CID 27260653) has the molecular formula C19H17FN2OS and a molecular weight of 340.42 g/mol. Its IUPAC name is (2R)-N-(2-fluorophenyl)-2-quinolin-2-ylsulfanylbutanamide.
| Compound Name | (2R)-N-(2-fluorophenyl)-2-quinolin-2-ylsulfanylbutanamide |
|---|---|
| PubChem CID | 27260653 |
| Molecular Formula | C19H17FN2OS |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | (2R)-N-(2-fluorophenyl)-2-quinolin-2-ylsulfanylbutanamide |
| SMILES | CC[C@@H](Sc1ccc2ccccc2n1)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C19H17FN2OS/c1-2-17(19(23)22-16-10-6-4-8-14(16)20)24-18-12-11-13-7-3-5-9-15(13)21-18/h3-12,17H,2H2,1H3,(H,22,23)/t17-/m1/s1 |
| InChIKey | ZSDCQCKZQFMUKU-QGZVFWFLSA-N |
| XLogP | 4.88 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |