C17H20FN3O2S — CID 42739159
2-(4-ethyl-1-methyl-6-oxopyrimidin-2-yl)sulfanyl-N-(2-fluorophenyl)butanamide (PubChem CID 42739159) has the molecular formula C17H20FN3O2S and a molecular weight of 349.43 g/mol. Its IUPAC name is 2-(4-ethyl-1-methyl-6-oxopyrimidin-2-yl)sulfanyl-N-(2-fluorophenyl)butanamide.
| Compound Name | 2-(4-ethyl-1-methyl-6-oxopyrimidin-2-yl)sulfanyl-N-(2-fluorophenyl)butanamide |
|---|---|
| PubChem CID | 42739159 |
| Molecular Formula | C17H20FN3O2S |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 2-(4-ethyl-1-methyl-6-oxopyrimidin-2-yl)sulfanyl-N-(2-fluorophenyl)butanamide |
| SMILES | CCc1cc(=O)n(C)c(SC(CC)C(=O)Nc2ccccc2F)n1 |
| InChI | InChI=1S/C17H20FN3O2S/c1-4-11-10-15(22)21(3)17(19-11)24-14(5-2)16(23)20-13-9-7-6-8-12(13)18/h6-10,14H,4-5H2,1-3H3,(H,20,23) |
| InChIKey | FUXLCAGCGCYCKM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |