C12H18N2O4S — CID 27260718
2-methoxy-5-(methylsulfamoyl)-N-propylbenzamide (PubChem CID 27260718) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is 2-methoxy-5-(methylsulfamoyl)-N-propylbenzamide.
| Compound Name | 2-methoxy-5-(methylsulfamoyl)-N-propylbenzamide |
|---|---|
| PubChem CID | 27260718 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2-methoxy-5-(methylsulfamoyl)-N-propylbenzamide |
| SMILES | CCCNC(=O)c1cc(S(=O)(=O)NC)ccc1OC |
| InChI | InChI=1S/C12H18N2O4S/c1-4-7-14-12(15)10-8-9(19(16,17)13-2)5-6-11(10)18-3/h5-6,8,13H,4,7H2,1-3H3,(H,14,15) |
| InChIKey | LQRBUSBUIMCPPC-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |