C20H22ClN3O5 — CID 27267674
2-[[2-(4-chloro-2-nitrophenoxy)acetyl]-propylamino]-N-(2-methylphenyl)acetamide (PubChem CID 27267674) has the molecular formula C20H22ClN3O5 and a molecular weight of 419.87 g/mol. Its IUPAC name is 2-[[2-(4-chloro-2-nitrophenoxy)acetyl]-propylamino]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[[2-(4-chloro-2-nitrophenoxy)acetyl]-propylamino]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 27267674 |
| Molecular Formula | C20H22ClN3O5 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 2-[[2-(4-chloro-2-nitrophenoxy)acetyl]-propylamino]-N-(2-methylphenyl)acetamide |
| SMILES | CCCN(CC(=O)Nc1ccccc1C)C(=O)COc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H22ClN3O5/c1-3-10-23(12-19(25)22-16-7-5-4-6-14(16)2)20(26)13-29-18-9-8-15(21)11-17(18)24(27)28/h4-9,11H,3,10,12-13H2,1-2H3,(H,22,25) |
| InChIKey | LLFKXTNAWXLKJX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|