C15H12ClF3N2OS — CID 2727022
N-(4-chlorophenyl)-6-ethylsulfanyl-4-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 2727022) has the molecular formula C15H12ClF3N2OS and a molecular weight of 360.79 g/mol. Its IUPAC name is N-(4-chlorophenyl)-6-ethylsulfanyl-4-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-(4-chlorophenyl)-6-ethylsulfanyl-4-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 2727022 |
| Molecular Formula | C15H12ClF3N2OS |
| Molecular Weight | 360.79 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | N-(4-chlorophenyl)-6-ethylsulfanyl-4-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CCSc1cc(C(F)(F)F)c(C(=O)Nc2ccc(Cl)cc2)cn1 |
| InChI | InChI=1S/C15H12ClF3N2OS/c1-2-23-13-7-12(15(17,18)19)11(8-20-13)14(22)21-10-5-3-9(16)4-6-10/h3-8H,2H2,1H3,(H,21,22) |
| InChIKey | VDNYFPDHQOLCFN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.79 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |