C17H25NO3S — CID 27275
2-(Diethylamino)ethyl (cyclopent-2-en-1-yl)(hydroxy)(thiophen-2-yl)acetate (PubChem CID 27275) has the molecular formula C17H25NO3S and a molecular weight of 323.50 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 2-cyclopent-2-en-1-yl-2-hydroxy-2-thiophen-2-ylacetate.
| Compound Name | 2-(Diethylamino)ethyl (cyclopent-2-en-1-yl)(hydroxy)(thiophen-2-yl)acetate |
|---|---|
| PubChem CID | 27275 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.50 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 2-(diethylamino)ethyl 2-cyclopent-2-en-1-yl-2-hydroxy-2-thiophen-2-ylacetate |
| SMILES | CCN(CC)CCOC(=O)C(C1CCC=C1)(C2=CC=CS2)O |
| InChI | InChI=1S/C17H25NO3S/c1-3-18(4-2)11-12-21-16(19)17(20,14-8-5-6-9-14)15-10-7-13-22-15/h5,7-8,10,13-14,20H,3-4,6,9,11-12H2,1-2H3 |
| InChIKey | HBARBPQISBWYCG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | 397 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|