C18H30NO3S+ — CID 6067
Penthienate (PubChem CID 6067) has the molecular formula C18H30NO3S+ and a molecular weight of 340.50 g/mol. Its IUPAC name is 2-(2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetyl)oxyethyl-diethyl-methylazanium.
| Compound Name | Penthienate |
|---|---|
| PubChem CID | 6067 |
| Molecular Formula | C18H30NO3S+ |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 2-(2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetyl)oxyethyl-diethyl-methylazanium |
| SMILES | CC[N+](C)(CC)CCOC(=O)C(C1CCCC1)(C2=CC=CS2)O |
| InChIKey | NEMLPWNINZELKP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 74.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | 394 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|