About [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 4-bromobenzenesulfonate;hydrochloride
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] 4-bromobenzenesulfonate;hydrochloride (PubChem CID 2728860) has the molecular formula C13H17BrClNO3S
and a molecular weight of 382.71 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 4-bromobenzenesulfonate;hydrochloride.
Molecular Properties
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 4-bromobenzenesulfonate;hydrochloride |
| PubChem CID | 2728860 |
| Molecular Formula | C13H17BrClNO3S |
| Molecular Weight | 382.71 g/mol |
| Exact Mass | 380.98 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 4-bromobenzenesulfonate;hydrochloride |
| SMILES | Cl.O=S(=O)(O[C@H]1CN2CCC1CC2)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H16BrNO3S.ClH/c14-11-1-3-12(4-2-11)19(16,17)18-13-9-15-7-5-10(13)6-8-15;/h1-4,10,13H,5-9H2;1H/t13-;/m0./s1 |
| InChIKey | BJRLJYOPMUBWJM-ZOWNYOTGSA-N |
| XLogP | 2.67 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.71 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 4-bromobenzenesulfonate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 4-bromobenzenesulfonate;hydrochloride?
The IUPAC name of [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 4-bromobenzenesulfonate;hydrochloride (CID 2728860) is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 4-bromobenzenesulfonate;hydrochloride.
What is the SMILES notation for [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 4-bromobenzenesulfonate;hydrochloride?
The canonical SMILES for [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 4-bromobenzenesulfonate;hydrochloride is Cl.O=S(=O)(O[C@H]1CN2CCC1CC2)c1ccc(Br)cc1.
What is the InChIKey of [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 4-bromobenzenesulfonate;hydrochloride?
The InChIKey is BJRLJYOPMUBWJM-ZOWNYOTGSA-N. The full InChI is InChI=1S/C13H16BrNO3S.ClH/c14-11-1-3-12(4-2-11)19(16,17)18-13-9-15-7-5-10(13)6-8-15;/h1-4,10,13H,5-9H2;1H/t13-;/m0./s1.
What are the key properties of [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 4-bromobenzenesulfonate;hydrochloride?
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] 4-bromobenzenesulfonate;hydrochloride has a molecular weight of 382.71 g/mol, XLogP of 2.67, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 4-bromobenzenesulfonate;hydrochloride is sourced from PubChem (CID 2728860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).