C13H15BrO3S — CID 98626241
[(1S,2R,5S)-2-bicyclo[3.2.0]heptanyl] 4-bromobenzenesulfonate (PubChem CID 98626241) has the molecular formula C13H15BrO3S and a molecular weight of 331.23 g/mol. Its IUPAC name is [(1S,2R,5S)-2-bicyclo[3.2.0]heptanyl] 4-bromobenzenesulfonate.
| Compound Name | [(1S,2R,5S)-2-bicyclo[3.2.0]heptanyl] 4-bromobenzenesulfonate |
|---|---|
| PubChem CID | 98626241 |
| Molecular Formula | C13H15BrO3S |
| Molecular Weight | 331.23 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | [(1S,2R,5S)-2-bicyclo[3.2.0]heptanyl] 4-bromobenzenesulfonate |
| SMILES | O=S(=O)(O[C@@H]1CC[C@@H]2CC[C@@H]21)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H15BrO3S/c14-10-3-5-11(6-4-10)18(15,16)17-13-8-2-9-1-7-12(9)13/h3-6,9,12-13H,1-2,7-8H2/t9-,12-,13+/m0/s1 |
| InChIKey | ICMSWNALDAFPPO-TVYUQYBPSA-N |
| XLogP | 3.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.23 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|