C18H15ClF6N2O2 — CID 2729352
N-[2-(4-chloroanilino)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-ethoxybenzamide (PubChem CID 2729352) has the molecular formula C18H15ClF6N2O2 and a molecular weight of 440.77 g/mol. Its IUPAC name is N-[2-(4-chloroanilino)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-ethoxybenzamide.
| Compound Name | N-[2-(4-chloroanilino)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-ethoxybenzamide |
|---|---|
| PubChem CID | 2729352 |
| Molecular Formula | C18H15ClF6N2O2 |
| Molecular Weight | 440.77 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | N-[2-(4-chloroanilino)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-ethoxybenzamide |
| SMILES | CCOc1ccccc1C(=O)NC(Nc1ccc(Cl)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H15ClF6N2O2/c1-2-29-14-6-4-3-5-13(14)15(28)27-16(17(20,21)22,18(23,24)25)26-12-9-7-11(19)8-10-12/h3-10,26H,2H2,1H3,(H,27,28) |
| InChIKey | ICIKEFWTYWIKCZ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.77 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|