C18H16F6N2O2 — CID 1241502
N-(2-anilino-1,1,1,3,3,3-hexafluoropropan-2-yl)-2-ethoxybenzamide (PubChem CID 1241502) has the molecular formula C18H16F6N2O2 and a molecular weight of 406.33 g/mol. Its IUPAC name is N-(2-anilino-1,1,1,3,3,3-hexafluoropropan-2-yl)-2-ethoxybenzamide.
| Compound Name | N-(2-anilino-1,1,1,3,3,3-hexafluoropropan-2-yl)-2-ethoxybenzamide |
|---|---|
| PubChem CID | 1241502 |
| Molecular Formula | C18H16F6N2O2 |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | N-(2-anilino-1,1,1,3,3,3-hexafluoropropan-2-yl)-2-ethoxybenzamide |
| SMILES | CCOc1ccccc1C(=O)NC(Nc1ccccc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H16F6N2O2/c1-2-28-14-11-7-6-10-13(14)15(27)26-16(17(19,20)21,18(22,23)24)25-12-8-4-3-5-9-12/h3-11,25H,2H2,1H3,(H,26,27) |
| InChIKey | NIDLZKLXUXJNJF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|