About Cyto8D3
Cyto8D3 (PubChem CID 2729615) has the molecular formula C19H20O4
and a molecular weight of 312.40 g/mol. Its IUPAC name is 2-methyl-5-[5-(4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)pentyl]cyclohexa-2,5-diene-1,4-dione.
Molecular Properties
| Compound Name | Cyto8D3 |
| PubChem CID | 2729615 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 2-methyl-5-[5-(4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)pentyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=CC(=O)C(=CC1=O)CCCCCC2=CC(=O)C(=CC2=O)C |
| InChI | InChI=1S/C19H20O4/c1-12-8-18(22)14(10-16(12)20)6-4-3-5-7-15-11-17(21)13(2)9-19(15)23/h8-11H,3-7H2,1-2H3 |
| InChIKey | BANPCENQUBNDKM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 68.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | 639 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze Cyto8D3 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Cyto8D3?
The IUPAC name of Cyto8D3 (CID 2729615) is 2-methyl-5-[5-(4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)pentyl]cyclohexa-2,5-diene-1,4-dione.
What is the SMILES notation for Cyto8D3?
The canonical SMILES for Cyto8D3 is CC1=CC(=O)C(=CC1=O)CCCCCC2=CC(=O)C(=CC2=O)C.
What is the InChIKey of Cyto8D3?
The InChIKey is BANPCENQUBNDKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20O4/c1-12-8-18(22)14(10-16(12)20)6-4-3-5-7-15-11-17(21)13(2)9-19(15)23/h8-11H,3-7H2,1-2H3.
What are the key properties of Cyto8D3?
Cyto8D3 has a molecular weight of 312.40 g/mol, XLogP of 2.70, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Cyto8D3 is sourced from PubChem (CID 2729615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).