C20H22O4 — CID 2729616
2-methyl-5-[6-(4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hexyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 2729616) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is 2-methyl-5-[6-(4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hexyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-methyl-5-[6-(4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hexyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 2729616 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 2-methyl-5-[6-(4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hexyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=CC(=O)C(CCCCCCC2=CC(=O)C(C)=CC2=O)=CC1=O |
| InChI | InChI=1S/C20H22O4/c1-13-9-19(23)15(11-17(13)21)7-5-3-4-6-8-16-12-18(22)14(2)10-20(16)24/h9-12H,3-8H2,1-2H3 |
| InChIKey | HUDMRDLXUKQXLD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|