About 2-bromo-4-phenylphenol
2-bromo-4-phenylphenol (PubChem CID 27297) has the molecular formula C12H9BrO
and a molecular weight of 249.11 g/mol. Its IUPAC name is 2-bromo-4-phenylphenol.
Molecular Properties
| Compound Name | 2-bromo-4-phenylphenol |
| PubChem CID | 27297 |
| Molecular Formula | C12H9BrO |
| Molecular Weight | 249.11 g/mol |
| Exact Mass | 247.98 |
| IUPAC Name | 2-bromo-4-phenylphenol |
| SMILES | Oc1ccc(-c2ccccc2)cc1Br |
| InChI | InChI=1S/C12H9BrO/c13-11-8-10(6-7-12(11)14)9-4-2-1-3-5-9/h1-8,14H |
| InChIKey | DZGMMVYPLBTLRQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.11 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-4-phenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-phenylphenol?
The IUPAC name of 2-bromo-4-phenylphenol (CID 27297) is 2-bromo-4-phenylphenol.
What is the SMILES notation for 2-bromo-4-phenylphenol?
The canonical SMILES for 2-bromo-4-phenylphenol is Oc1ccc(-c2ccccc2)cc1Br.
What is the InChIKey of 2-bromo-4-phenylphenol?
The InChIKey is DZGMMVYPLBTLRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BrO/c13-11-8-10(6-7-12(11)14)9-4-2-1-3-5-9/h1-8,14H.
What are the key properties of 2-bromo-4-phenylphenol?
2-bromo-4-phenylphenol has a molecular weight of 249.11 g/mol, XLogP of 3.82, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-phenylphenol is sourced from PubChem (CID 27297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).