About 4-benzylphenol
4-benzylphenol (PubChem CID 7563) has the molecular formula C13H12O
and a molecular weight of 184.24 g/mol. Its IUPAC name is 4-benzylphenol.
Molecular Properties
| Compound Name | 4-benzylphenol |
| PubChem CID | 7563 |
| Molecular Formula | C13H12O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 4-benzylphenol |
| SMILES | Oc1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12O/c14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9,14H,10H2 |
| InChIKey | HJSPWKGEPDZNLK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-benzylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzylphenol?
The IUPAC name of 4-benzylphenol (CID 7563) is 4-benzylphenol.
What is the SMILES notation for 4-benzylphenol?
The canonical SMILES for 4-benzylphenol is Oc1ccc(Cc2ccccc2)cc1.
What is the InChIKey of 4-benzylphenol?
The InChIKey is HJSPWKGEPDZNLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O/c14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9,14H,10H2.
What are the key properties of 4-benzylphenol?
4-benzylphenol has a molecular weight of 184.24 g/mol, XLogP of 2.98, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzylphenol is sourced from PubChem (CID 7563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).