C16H12F2N2O3S — CID 2730729
N-(2,4-difluorophenyl)-N-(7-oxo-5,6-dihydro-4H-1,3-thiazepin-2-yl)furan-2-carboxamide (PubChem CID 2730729) has the molecular formula C16H12F2N2O3S and a molecular weight of 350.35 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-N-(7-oxo-5,6-dihydro-4H-1,3-thiazepin-2-yl)furan-2-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-N-(7-oxo-5,6-dihydro-4H-1,3-thiazepin-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 2730729 |
| Molecular Formula | C16H12F2N2O3S |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | N-(2,4-difluorophenyl)-N-(7-oxo-5,6-dihydro-4H-1,3-thiazepin-2-yl)furan-2-carboxamide |
| SMILES | O=C1CCCN=C(N(C(=O)c2ccco2)c2ccc(F)cc2F)S1 |
| InChI | InChI=1S/C16H12F2N2O3S/c17-10-5-6-12(11(18)9-10)20(15(22)13-3-2-8-23-13)16-19-7-1-4-14(21)24-16/h2-3,5-6,8-9H,1,4,7H2 |
| InChIKey | DXXCTDAMLFBZEQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 62.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|