C14H13F3N2O3S2 — CID 27308204
N-[(3aR,6aR)-5,5-dioxo-3-[2-(trifluoromethyl)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]acetamide (PubChem CID 27308204) has the molecular formula C14H13F3N2O3S2 and a molecular weight of 378.40 g/mol. Its IUPAC name is N-[(3aR,6aR)-5,5-dioxo-3-[2-(trifluoromethyl)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]acetamide.
| Compound Name | N-[(3aR,6aR)-5,5-dioxo-3-[2-(trifluoromethyl)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]acetamide |
|---|---|
| PubChem CID | 27308204 |
| Molecular Formula | C14H13F3N2O3S2 |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | N-[(3aR,6aR)-5,5-dioxo-3-[2-(trifluoromethyl)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]acetamide |
| SMILES | CC(=O)/N=C1\S[C@H]2CS(=O)(=O)C[C@H]2N1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H13F3N2O3S2/c1-8(20)18-13-19(11-6-24(21,22)7-12(11)23-13)10-5-3-2-4-9(10)14(15,16)17/h2-5,11-12H,6-7H2,1H3/b18-13-/t11-,12+/m1/s1 |
| InChIKey | SDNUEOONSXNEKS-UXXLYEAISA-N |
| XLogP | 2.33 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|