C20H16ClF3N2O3S2 — CID 39738114
N-[(3aS,6aS)-5,5-dioxo-3-[2-(trifluoromethyl)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-chlorophenyl)acetamide (PubChem CID 39738114) has the molecular formula C20H16ClF3N2O3S2 and a molecular weight of 488.94 g/mol. Its IUPAC name is N-[(3aS,6aS)-5,5-dioxo-3-[2-(trifluoromethyl)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-chlorophenyl)acetamide.
| Compound Name | N-[(3aS,6aS)-5,5-dioxo-3-[2-(trifluoromethyl)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 39738114 |
| Molecular Formula | C20H16ClF3N2O3S2 |
| Molecular Weight | 488.94 g/mol |
| Exact Mass | 488.02 |
| IUPAC Name | N-[(3aS,6aS)-5,5-dioxo-3-[2-(trifluoromethyl)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-chlorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)/N=C1\S[C@@H]2CS(=O)(=O)C[C@@H]2N1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H16ClF3N2O3S2/c21-13-7-5-12(6-8-13)9-18(27)25-19-26(16-10-31(28,29)11-17(16)30-19)15-4-2-1-3-14(15)20(22,23)24/h1-8,16-17H,9-11H2/b25-19-/t16-,17+/m0/s1 |
| InChIKey | VRPKOSYRCHYYCF-WQJFPSLYSA-N |
| XLogP | 4.20 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.94 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|