C22H23ClN2O3S2 — CID 39741335
N-[(3aS,6aR)-5,5-dioxo-3-(2-propan-2-ylphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-chlorophenyl)acetamide (PubChem CID 39741335) has the molecular formula C22H23ClN2O3S2 and a molecular weight of 463.02 g/mol. Its IUPAC name is N-[(3aS,6aR)-5,5-dioxo-3-(2-propan-2-ylphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-chlorophenyl)acetamide.
| Compound Name | N-[(3aS,6aR)-5,5-dioxo-3-(2-propan-2-ylphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 39741335 |
| Molecular Formula | C22H23ClN2O3S2 |
| Molecular Weight | 463.02 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | N-[(3aS,6aR)-5,5-dioxo-3-(2-propan-2-ylphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-chlorophenyl)acetamide |
| SMILES | CC(C)c1ccccc1N1/C(=N/C(=O)Cc2ccc(Cl)cc2)S[C@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C22H23ClN2O3S2/c1-14(2)17-5-3-4-6-18(17)25-19-12-30(27,28)13-20(19)29-22(25)24-21(26)11-15-7-9-16(23)10-8-15/h3-10,14,19-20H,11-13H2,1-2H3/b24-22-/t19-,20-/m0/s1 |
| InChIKey | XLVGKORBZOOFMB-FHXNKAKFSA-N |
| XLogP | 4.31 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.02 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|