C23H26N2O4S2 — CID 43838904
N-[5,5-dioxo-3-(2-propan-2-ylphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-methoxyphenyl)acetamide (PubChem CID 43838904) has the molecular formula C23H26N2O4S2 and a molecular weight of 458.61 g/mol. Its IUPAC name is N-[5,5-dioxo-3-(2-propan-2-ylphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[5,5-dioxo-3-(2-propan-2-ylphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 43838904 |
| Molecular Formula | C23H26N2O4S2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | N-[5,5-dioxo-3-(2-propan-2-ylphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)/N=C2\SC3CS(=O)(=O)CC3N2c2ccccc2C(C)C)cc1 |
| InChI | InChI=1S/C23H26N2O4S2/c1-15(2)18-6-4-5-7-19(18)25-20-13-31(27,28)14-21(20)30-23(25)24-22(26)12-16-8-10-17(29-3)11-9-16/h4-11,15,20-21H,12-14H2,1-3H3/b24-23- |
| InChIKey | JPTULRFMTFGEGI-VHXPQNKSSA-N |
| XLogP | 3.66 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|