C22H24N2O4S2 — CID 39739114
N-[(3aR,6aS)-3-(2,3-dimethylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-methoxyphenyl)acetamide (PubChem CID 39739114) has the molecular formula C22H24N2O4S2 and a molecular weight of 444.58 g/mol. Its IUPAC name is N-[(3aR,6aS)-3-(2,3-dimethylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[(3aR,6aS)-3-(2,3-dimethylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 39739114 |
| Molecular Formula | C22H24N2O4S2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | N-[(3aR,6aS)-3-(2,3-dimethylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)/N=C2\S[C@@H]3CS(=O)(=O)C[C@H]3N2c2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C22H24N2O4S2/c1-14-5-4-6-18(15(14)2)24-19-12-30(26,27)13-20(19)29-22(24)23-21(25)11-16-7-9-17(28-3)10-8-16/h4-10,19-20H,11-13H2,1-3H3/b23-22-/t19-,20-/m1/s1 |
| InChIKey | XQDZBBVZTVEXIK-RXUIDFICSA-N |
| XLogP | 3.16 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|