C27H26N2O5S2 — CID 39741519
N-[(3aS,6aR)-5,5-dioxo-3-(4-phenylmethoxyphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-methoxyphenyl)acetamide (PubChem CID 39741519) has the molecular formula C27H26N2O5S2 and a molecular weight of 522.65 g/mol. Its IUPAC name is N-[(3aS,6aR)-5,5-dioxo-3-(4-phenylmethoxyphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[(3aS,6aR)-5,5-dioxo-3-(4-phenylmethoxyphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 39741519 |
| Molecular Formula | C27H26N2O5S2 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | N-[(3aS,6aR)-5,5-dioxo-3-(4-phenylmethoxyphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)/N=C2\S[C@H]3CS(=O)(=O)C[C@@H]3N2c2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H26N2O5S2/c1-33-22-11-7-19(8-12-22)15-26(30)28-27-29(24-17-36(31,32)18-25(24)35-27)21-9-13-23(14-10-21)34-16-20-5-3-2-4-6-20/h2-14,24-25H,15-18H2,1H3/b28-27-/t24-,25-/m0/s1 |
| InChIKey | OPJPOSZGWYNDGP-ONHCCZHASA-N |
| XLogP | 4.12 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|