C28H28N2O6S2 — CID 43839031
2-(3,4-dimethoxyphenyl)-N-[5,5-dioxo-3-(4-phenylmethoxyphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]acetamide (PubChem CID 43839031) has the molecular formula C28H28N2O6S2 and a molecular weight of 552.67 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[5,5-dioxo-3-(4-phenylmethoxyphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[5,5-dioxo-3-(4-phenylmethoxyphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]acetamide |
|---|---|
| PubChem CID | 43839031 |
| Molecular Formula | C28H28N2O6S2 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.14 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[5,5-dioxo-3-(4-phenylmethoxyphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]acetamide |
| SMILES | COc1ccc(CC(=O)/N=C2\SC3CS(=O)(=O)CC3N2c2ccc(OCc3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C28H28N2O6S2/c1-34-24-13-8-20(14-25(24)35-2)15-27(31)29-28-30(23-17-38(32,33)18-26(23)37-28)21-9-11-22(12-10-21)36-16-19-6-4-3-5-7-19/h3-14,23,26H,15-18H2,1-2H3/b29-28- |
| InChIKey | XLFSPUCRNYNLFJ-ZIADKAODSA-N |
| XLogP | 4.13 |
| TPSA | 94.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|