C23H26N2O7S2 — CID 39737107
N-[(3aR,6aS)-3-(2,5-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 39737107) has the molecular formula C23H26N2O7S2 and a molecular weight of 506.60 g/mol. Its IUPAC name is N-[(3aR,6aS)-3-(2,5-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-[(3aR,6aS)-3-(2,5-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 39737107 |
| Molecular Formula | C23H26N2O7S2 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | N-[(3aR,6aS)-3-(2,5-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(OC)c(N2/C(=N/C(=O)Cc3ccc(OC)c(OC)c3)S[C@@H]3CS(=O)(=O)C[C@H]32)c1 |
| InChI | InChI=1S/C23H26N2O7S2/c1-29-15-6-8-18(30-2)16(11-15)25-17-12-34(27,28)13-21(17)33-23(25)24-22(26)10-14-5-7-19(31-3)20(9-14)32-4/h5-9,11,17,21H,10,12-13H2,1-4H3/b24-23-/t17-,21-/m1/s1 |
| InChIKey | MFEVAZAYWCRNSA-UNNIRDPWSA-N |
| XLogP | 2.57 |
| TPSA | 103.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|