C22H21F3N2O6S2 — CID 43838792
2-(3,4-dimethoxyphenyl)-N-[5,5-dioxo-3-[4-(trifluoromethoxy)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]acetamide (PubChem CID 43838792) has the molecular formula C22H21F3N2O6S2 and a molecular weight of 530.55 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[5,5-dioxo-3-[4-(trifluoromethoxy)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[5,5-dioxo-3-[4-(trifluoromethoxy)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]acetamide |
|---|---|
| PubChem CID | 43838792 |
| Molecular Formula | C22H21F3N2O6S2 |
| Molecular Weight | 530.55 g/mol |
| Exact Mass | 530.08 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[5,5-dioxo-3-[4-(trifluoromethoxy)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]acetamide |
| SMILES | COc1ccc(CC(=O)/N=C2\SC3CS(=O)(=O)CC3N2c2ccc(OC(F)(F)F)cc2)cc1OC |
| InChI | InChI=1S/C22H21F3N2O6S2/c1-31-17-8-3-13(9-18(17)32-2)10-20(28)26-21-27(16-11-35(29,30)12-19(16)34-21)14-4-6-15(7-5-14)33-22(23,24)25/h3-9,16,19H,10-12H2,1-2H3/b26-21- |
| InChIKey | RFXILHSPYHPWFF-QLYXXIJNSA-N |
| XLogP | 3.45 |
| TPSA | 94.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.55 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|